C12H13ClN2O2S — CID 135041170
methyl (3R,4S,5S)-4-chloro-3-methyl-5-phenylsulfanyl-3,4-dihydropyrazole-5-carboxylate (PubChem CID 135041170) has the molecular formula C12H13ClN2O2S and a molecular weight of 284.77 g/mol. Its IUPAC name is methyl (3R,4S,5S)-4-chloro-3-methyl-5-phenylsulfanyl-3,4-dihydropyrazole-5-carboxylate.
| Compound Name | methyl (3R,4S,5S)-4-chloro-3-methyl-5-phenylsulfanyl-3,4-dihydropyrazole-5-carboxylate |
|---|---|
| PubChem CID | 135041170 |
| Molecular Formula | C12H13ClN2O2S |
| Molecular Weight | 284.77 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | methyl (3R,4S,5S)-4-chloro-3-methyl-5-phenylsulfanyl-3,4-dihydropyrazole-5-carboxylate |
| SMILES | COC(=O)[C@@]1(Sc2ccccc2)N=N[C@H](C)[C@@H]1Cl |
| InChI | InChI=1S/C12H13ClN2O2S/c1-8-10(13)12(15-14-8,11(16)17-2)18-9-6-4-3-5-7-9/h3-8,10H,1-2H3/t8-,10+,12-/m1/s1 |
| InChIKey | FDBPUUKXQIZPQK-UBHAPETDSA-N |
| XLogP | 3.11 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.77 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|