C36H54O5S — CID 135050319
2-[(4R)-2-(benzenesulfonyl)-4-[(5R)-8-ethoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]pentyl]-2-methyl-1,3-dioxolane (PubChem CID 135050319) has the molecular formula C36H54O5S and a molecular weight of 598.89 g/mol. Its IUPAC name is 2-[(4R)-2-(benzenesulfonyl)-4-[(5R)-8-ethoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]pentyl]-2-methyl-1,3-dioxolane.
| Compound Name | 2-[(4R)-2-(benzenesulfonyl)-4-[(5R)-8-ethoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]pentyl]-2-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 135050319 |
| Molecular Formula | C36H54O5S |
| Molecular Weight | 598.89 g/mol |
| Exact Mass | 598.37 |
| IUPAC Name | 2-[(4R)-2-(benzenesulfonyl)-4-[(5R)-8-ethoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]pentyl]-2-methyl-1,3-dioxolane |
| SMILES | CCOC1CC2C3CCC([C@H](C)CC(CC4(C)OCCO4)S(=O)(=O)c4ccccc4)C3(C)CCC2C2(C)CC[C@@H]3CC132 |
| InChI | InChI=1S/C36H54O5S/c1-6-39-32-21-28-30-13-12-29(33(30,3)16-15-31(28)34(4)17-14-25-22-36(25,32)34)24(2)20-27(23-35(5)40-18-19-41-35)42(37,38)26-10-8-7-9-11-26/h7-11,24-25,27-32H,6,12-23H2,1-5H3/t24-,25-,27?,28?,29?,30?,31?,32?,33?,34?,36?/m1/s1 |
| InChIKey | LHZJIJYYOYJNFS-LMVDTICRSA-N |
| XLogP | 7.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.89 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |