C9H21N2Si+ — CID 135062535
(1,3-dimethyl-5,6-dihydro-4H-pyrimidin-1-ium-2-yl)-trimethylsilane (PubChem CID 135062535) has the molecular formula C9H21N2Si+ and a molecular weight of 185.37 g/mol. Its IUPAC name is (1,3-dimethyl-5,6-dihydro-4H-pyrimidin-1-ium-2-yl)-trimethylsilane.
| Compound Name | (1,3-dimethyl-5,6-dihydro-4H-pyrimidin-1-ium-2-yl)-trimethylsilane |
|---|---|
| PubChem CID | 135062535 |
| Molecular Formula | C9H21N2Si+ |
| Molecular Weight | 185.37 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | (1,3-dimethyl-5,6-dihydro-4H-pyrimidin-1-ium-2-yl)-trimethylsilane |
| SMILES | CN1CCC[N+](C)=C1[Si](C)(C)C |
| InChI | InChI=1S/C9H21N2Si/c1-10-7-6-8-11(2)9(10)12(3,4)5/h6-8H2,1-5H3/q+1 |
| InChIKey | CFRBZYPNWHRSOM-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|