C8H13N2S+ — CID 45089016
3,8-dimethyl-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-4-ium (PubChem CID 45089016) has the molecular formula C8H13N2S+ and a molecular weight of 169.27 g/mol. Its IUPAC name is 3,8-dimethyl-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-4-ium.
| Compound Name | 3,8-dimethyl-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-4-ium |
|---|---|
| PubChem CID | 45089016 |
| Molecular Formula | C8H13N2S+ |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.08 |
| IUPAC Name | 3,8-dimethyl-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-4-ium |
| SMILES | Cc1csc2[n+]1CCCN2C |
| InChI | InChI=1S/C8H13N2S/c1-7-6-11-8-9(2)4-3-5-10(7)8/h6H,3-5H2,1-2H3/q+1 |
| InChIKey | ZSKLYELTIVLDKH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|