C13H11N3O4 — CID 135063132
4-hydroxy-5-nitro-1-phenyl-3,7-dihydro-2H-pyrrolo[2,3-b]pyridin-6-one (PubChem CID 135063132) has the molecular formula C13H11N3O4 and a molecular weight of 273.25 g/mol. Its IUPAC name is 4-hydroxy-5-nitro-1-phenyl-3,7-dihydro-2H-pyrrolo[2,3-b]pyridin-6-one.
| Compound Name | 4-hydroxy-5-nitro-1-phenyl-3,7-dihydro-2H-pyrrolo[2,3-b]pyridin-6-one |
|---|---|
| PubChem CID | 135063132 |
| Molecular Formula | C13H11N3O4 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 4-hydroxy-5-nitro-1-phenyl-3,7-dihydro-2H-pyrrolo[2,3-b]pyridin-6-one |
| SMILES | O=c1[nH]c2c(c(O)c1[N+](=O)[O-])CCN2c1ccccc1 |
| InChI | InChI=1S/C13H11N3O4/c17-11-9-6-7-15(8-4-2-1-3-5-8)12(9)14-13(18)10(11)16(19)20/h1-5H,6-7H2,(H2,14,17,18) |
| InChIKey | RSFXDKRFBLZXJF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 99.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|