C21H17BrF6N2O — CID 135063241
(1Z)-N-[6-[(4-bromophenyl)methyl]-2,3,4,5-tetrahydropyridin-1-ium-1-yl]-3,5-bis(trifluoromethyl)benzenecarboximidate (PubChem CID 135063241) has the molecular formula C21H17BrF6N2O and a molecular weight of 507.27 g/mol. Its IUPAC name is (1Z)-N-[6-[(4-bromophenyl)methyl]-2,3,4,5-tetrahydropyridin-1-ium-1-yl]-3,5-bis(trifluoromethyl)benzenecarboximidate.
| Compound Name | (1Z)-N-[6-[(4-bromophenyl)methyl]-2,3,4,5-tetrahydropyridin-1-ium-1-yl]-3,5-bis(trifluoromethyl)benzenecarboximidate |
|---|---|
| PubChem CID | 135063241 |
| Molecular Formula | C21H17BrF6N2O |
| Molecular Weight | 507.27 g/mol |
| Exact Mass | 506.04 |
| IUPAC Name | (1Z)-N-[6-[(4-bromophenyl)methyl]-2,3,4,5-tetrahydropyridin-1-ium-1-yl]-3,5-bis(trifluoromethyl)benzenecarboximidate |
| SMILES | [O-]/C(=N\[N+]1=C(Cc2ccc(Br)cc2)CCCC1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H17BrF6N2O/c22-17-6-4-13(5-7-17)9-18-3-1-2-8-30(18)29-19(31)14-10-15(20(23,24)25)12-16(11-14)21(26,27)28/h4-7,10-12H,1-3,8-9H2 |
| InChIKey | JEFPRBUIFMKNNA-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.27 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|