C20H16F6N2O — CID 135063418
(1Z)-N-(5-benzyl-3,4-dihydro-2H-pyrrol-1-ium-1-yl)-3,5-bis(trifluoromethyl)benzenecarboximidate (PubChem CID 135063418) has the molecular formula C20H16F6N2O and a molecular weight of 414.35 g/mol. Its IUPAC name is (1Z)-N-(5-benzyl-3,4-dihydro-2H-pyrrol-1-ium-1-yl)-3,5-bis(trifluoromethyl)benzenecarboximidate.
| Compound Name | (1Z)-N-(5-benzyl-3,4-dihydro-2H-pyrrol-1-ium-1-yl)-3,5-bis(trifluoromethyl)benzenecarboximidate |
|---|---|
| PubChem CID | 135063418 |
| Molecular Formula | C20H16F6N2O |
| Molecular Weight | 414.35 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | (1Z)-N-(5-benzyl-3,4-dihydro-2H-pyrrol-1-ium-1-yl)-3,5-bis(trifluoromethyl)benzenecarboximidate |
| SMILES | [O-]/C(=N\[N+]1=C(Cc2ccccc2)CCC1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H16F6N2O/c21-19(22,23)15-10-14(11-16(12-15)20(24,25)26)18(29)27-28-8-4-7-17(28)9-13-5-2-1-3-6-13/h1-3,5-6,10-12H,4,7-9H2 |
| InChIKey | RANOFTJJRCVDCZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|