C14H12F6N2O — CID 135063416
(1Z)-N-(5-methyl-3,4-dihydro-2H-pyrrol-1-ium-1-yl)-3,5-bis(trifluoromethyl)benzenecarboximidate (PubChem CID 135063416) has the molecular formula C14H12F6N2O and a molecular weight of 338.25 g/mol. Its IUPAC name is (1Z)-N-(5-methyl-3,4-dihydro-2H-pyrrol-1-ium-1-yl)-3,5-bis(trifluoromethyl)benzenecarboximidate.
| Compound Name | (1Z)-N-(5-methyl-3,4-dihydro-2H-pyrrol-1-ium-1-yl)-3,5-bis(trifluoromethyl)benzenecarboximidate |
|---|---|
| PubChem CID | 135063416 |
| Molecular Formula | C14H12F6N2O |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | (1Z)-N-(5-methyl-3,4-dihydro-2H-pyrrol-1-ium-1-yl)-3,5-bis(trifluoromethyl)benzenecarboximidate |
| SMILES | CC1=[N+](/N=C(\[O-])c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CCC1 |
| InChI | InChI=1S/C14H12F6N2O/c1-8-3-2-4-22(8)21-12(23)9-5-10(13(15,16)17)7-11(6-9)14(18,19)20/h5-7H,2-4H2,1H3 |
| InChIKey | SJVPVMGVYWFEFG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|