C21H18F6N2O — CID 135062811
(1Z)-N-(6-benzyl-2,3,4,5-tetrahydropyridin-1-ium-1-yl)-3,5-bis(trifluoromethyl)benzenecarboximidate (PubChem CID 135062811) has the molecular formula C21H18F6N2O and a molecular weight of 428.38 g/mol. Its IUPAC name is (1Z)-N-(6-benzyl-2,3,4,5-tetrahydropyridin-1-ium-1-yl)-3,5-bis(trifluoromethyl)benzenecarboximidate.
| Compound Name | (1Z)-N-(6-benzyl-2,3,4,5-tetrahydropyridin-1-ium-1-yl)-3,5-bis(trifluoromethyl)benzenecarboximidate |
|---|---|
| PubChem CID | 135062811 |
| Molecular Formula | C21H18F6N2O |
| Molecular Weight | 428.38 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | (1Z)-N-(6-benzyl-2,3,4,5-tetrahydropyridin-1-ium-1-yl)-3,5-bis(trifluoromethyl)benzenecarboximidate |
| SMILES | [O-]/C(=N\[N+]1=C(Cc2ccccc2)CCCC1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H18F6N2O/c22-20(23,24)16-11-15(12-17(13-16)21(25,26)27)19(30)28-29-9-5-4-8-18(29)10-14-6-2-1-3-7-14/h1-3,6-7,11-13H,4-5,8-10H2 |
| InChIKey | BGBMGDNLDGETBV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|