C15H14F6N2O — CID 135062801
(1Z)-N-(6-methyl-2,3,4,5-tetrahydropyridin-1-ium-1-yl)-3,5-bis(trifluoromethyl)benzenecarboximidate (PubChem CID 135062801) has the molecular formula C15H14F6N2O and a molecular weight of 352.28 g/mol. Its IUPAC name is (1Z)-N-(6-methyl-2,3,4,5-tetrahydropyridin-1-ium-1-yl)-3,5-bis(trifluoromethyl)benzenecarboximidate.
| Compound Name | (1Z)-N-(6-methyl-2,3,4,5-tetrahydropyridin-1-ium-1-yl)-3,5-bis(trifluoromethyl)benzenecarboximidate |
|---|---|
| PubChem CID | 135062801 |
| Molecular Formula | C15H14F6N2O |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | (1Z)-N-(6-methyl-2,3,4,5-tetrahydropyridin-1-ium-1-yl)-3,5-bis(trifluoromethyl)benzenecarboximidate |
| SMILES | CC1=[N+](/N=C(\[O-])c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CCCC1 |
| InChI | InChI=1S/C15H14F6N2O/c1-9-4-2-3-5-23(9)22-13(24)10-6-11(14(16,17)18)8-12(7-10)15(19,20)21/h6-8H,2-5H2,1H3 |
| InChIKey | OYRJXNMIJHUWMM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|