C19H22F6N2O — CID 135062996
(1Z)-N-(2-butyl-6-methyl-2,3,4,5-tetrahydropyridin-1-ium-1-yl)-3,5-bis(trifluoromethyl)benzenecarboximidate (PubChem CID 135062996) has the molecular formula C19H22F6N2O and a molecular weight of 408.39 g/mol. Its IUPAC name is (1Z)-N-(2-butyl-6-methyl-2,3,4,5-tetrahydropyridin-1-ium-1-yl)-3,5-bis(trifluoromethyl)benzenecarboximidate.
| Compound Name | (1Z)-N-(2-butyl-6-methyl-2,3,4,5-tetrahydropyridin-1-ium-1-yl)-3,5-bis(trifluoromethyl)benzenecarboximidate |
|---|---|
| PubChem CID | 135062996 |
| Molecular Formula | C19H22F6N2O |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | (1Z)-N-(2-butyl-6-methyl-2,3,4,5-tetrahydropyridin-1-ium-1-yl)-3,5-bis(trifluoromethyl)benzenecarboximidate |
| SMILES | CCCCC1CCCC(C)=[N+]1/N=C(\[O-])c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H22F6N2O/c1-3-4-7-16-8-5-6-12(2)27(16)26-17(28)13-9-14(18(20,21)22)11-15(10-13)19(23,24)25/h9-11,16H,3-8H2,1-2H3 |
| InChIKey | ZASUHNFWVDRLDJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|