C23H22F6N2O — CID 135063226
(1Z)-N-[6-[(3,5-dimethylphenyl)methyl]-2,3,4,5-tetrahydropyridin-1-ium-1-yl]-3,5-bis(trifluoromethyl)benzenecarboximidate (PubChem CID 135063226) has the molecular formula C23H22F6N2O and a molecular weight of 456.43 g/mol. Its IUPAC name is (1Z)-N-[6-[(3,5-dimethylphenyl)methyl]-2,3,4,5-tetrahydropyridin-1-ium-1-yl]-3,5-bis(trifluoromethyl)benzenecarboximidate.
| Compound Name | (1Z)-N-[6-[(3,5-dimethylphenyl)methyl]-2,3,4,5-tetrahydropyridin-1-ium-1-yl]-3,5-bis(trifluoromethyl)benzenecarboximidate |
|---|---|
| PubChem CID | 135063226 |
| Molecular Formula | C23H22F6N2O |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | (1Z)-N-[6-[(3,5-dimethylphenyl)methyl]-2,3,4,5-tetrahydropyridin-1-ium-1-yl]-3,5-bis(trifluoromethyl)benzenecarboximidate |
| SMILES | Cc1cc(C)cc(CC2=[N+](/N=C(\[O-])c3cc(C(F)(F)F)cc(C(F)(F)F)c3)CCCC2)c1 |
| InChI | InChI=1S/C23H22F6N2O/c1-14-7-15(2)9-16(8-14)10-20-5-3-4-6-31(20)30-21(32)17-11-18(22(24,25)26)13-19(12-17)23(27,28)29/h7-9,11-13H,3-6,10H2,1-2H3 |
| InChIKey | QMDQUKDOKMDDGF-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|