C26H39N3O2S — CID 135064007
(NE)-N-(3-butyl-1-cyclohexyl-4-cyclohexyliminoazetidin-2-ylidene)-4-methylbenzenesulfonamide (PubChem CID 135064007) has the molecular formula C26H39N3O2S and a molecular weight of 457.68 g/mol. Its IUPAC name is (NE)-N-(3-butyl-1-cyclohexyl-4-cyclohexyliminoazetidin-2-ylidene)-4-methylbenzenesulfonamide.
| Compound Name | (NE)-N-(3-butyl-1-cyclohexyl-4-cyclohexyliminoazetidin-2-ylidene)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 135064007 |
| Molecular Formula | C26H39N3O2S |
| Molecular Weight | 457.68 g/mol |
| Exact Mass | 457.28 |
| IUPAC Name | (NE)-N-(3-butyl-1-cyclohexyl-4-cyclohexyliminoazetidin-2-ylidene)-4-methylbenzenesulfonamide |
| SMILES | CCCCC1/C(=N\C2CCCCC2)N(C2CCCCC2)/C1=N/S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H39N3O2S/c1-3-4-15-24-25(27-21-11-7-5-8-12-21)29(22-13-9-6-10-14-22)26(24)28-32(30,31)23-18-16-20(2)17-19-23/h16-19,21-22,24H,3-15H2,1-2H3/b27-25+,28-26+ |
| InChIKey | SNJGHZPQCOVSNI-NBHCHVEOSA-N |
| XLogP | 6.27 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.68 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|