C22H21ClN2 — CID 135067343
(7S)-5-benzyl-2-(4-chlorophenyl)-7-ethenyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridine (PubChem CID 135067343) has the molecular formula C22H21ClN2 and a molecular weight of 348.88 g/mol. Its IUPAC name is (7S)-5-benzyl-2-(4-chlorophenyl)-7-ethenyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridine.
| Compound Name | (7S)-5-benzyl-2-(4-chlorophenyl)-7-ethenyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 135067343 |
| Molecular Formula | C22H21ClN2 |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | (7S)-5-benzyl-2-(4-chlorophenyl)-7-ethenyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridine |
| SMILES | C=C[C@H]1CN(Cc2ccccc2)Cc2cc(-c3ccc(Cl)cc3)[nH]c21 |
| InChI | InChI=1S/C22H21ClN2/c1-2-17-14-25(13-16-6-4-3-5-7-16)15-19-12-21(24-22(17)19)18-8-10-20(23)11-9-18/h2-12,17,24H,1,13-15H2/t17-/m0/s1 |
| InChIKey | NPJQSBOEXDYJRK-KRWDZBQOSA-N |
| XLogP | 5.62 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|