C18H18ClNO — CID 135066727
(4R)-2-benzyl-8-chloro-4-ethenyl-3,4-dihydro-1H-isoquinolin-7-ol (PubChem CID 135066727) has the molecular formula C18H18ClNO and a molecular weight of 299.80 g/mol. Its IUPAC name is (4R)-2-benzyl-8-chloro-4-ethenyl-3,4-dihydro-1H-isoquinolin-7-ol.
| Compound Name | (4R)-2-benzyl-8-chloro-4-ethenyl-3,4-dihydro-1H-isoquinolin-7-ol |
|---|---|
| PubChem CID | 135066727 |
| Molecular Formula | C18H18ClNO |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | (4R)-2-benzyl-8-chloro-4-ethenyl-3,4-dihydro-1H-isoquinolin-7-ol |
| SMILES | C=C[C@H]1CN(Cc2ccccc2)Cc2c1ccc(O)c2Cl |
| InChI | InChI=1S/C18H18ClNO/c1-2-14-11-20(10-13-6-4-3-5-7-13)12-16-15(14)8-9-17(21)18(16)19/h2-9,14,21H,1,10-12H2/t14-/m0/s1 |
| InChIKey | JCANOZUPEMVCIK-AWEZNQCLSA-N |
| XLogP | 4.33 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|