C30H32N2O7 — CID 135068810
(2R,4aR,9aR)-1,1,4a-trimethyl-6-[(4-nitrophenyl)methoxy]-5-[(4-nitrophenyl)methyl]-3,4,9,9a-tetrahydro-2H-xanthen-2-ol (PubChem CID 135068810) has the molecular formula C30H32N2O7 and a molecular weight of 532.59 g/mol. Its IUPAC name is (2R,4aR,9aR)-1,1,4a-trimethyl-6-[(4-nitrophenyl)methoxy]-5-[(4-nitrophenyl)methyl]-3,4,9,9a-tetrahydro-2H-xanthen-2-ol.
| Compound Name | (2R,4aR,9aR)-1,1,4a-trimethyl-6-[(4-nitrophenyl)methoxy]-5-[(4-nitrophenyl)methyl]-3,4,9,9a-tetrahydro-2H-xanthen-2-ol |
|---|---|
| PubChem CID | 135068810 |
| Molecular Formula | C30H32N2O7 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | (2R,4aR,9aR)-1,1,4a-trimethyl-6-[(4-nitrophenyl)methoxy]-5-[(4-nitrophenyl)methyl]-3,4,9,9a-tetrahydro-2H-xanthen-2-ol |
| SMILES | CC1(C)[C@H](O)CC[C@@]2(C)Oc3c(ccc(OCc4ccc([N+](=O)[O-])cc4)c3Cc3ccc([N+](=O)[O-])cc3)C[C@H]12 |
| InChI | InChI=1S/C30H32N2O7/c1-29(2)26-17-21-8-13-25(38-18-20-6-11-23(12-7-20)32(36)37)24(16-19-4-9-22(10-5-19)31(34)35)28(21)39-30(26,3)15-14-27(29)33/h4-13,26-27,33H,14-18H2,1-3H3/t26-,27-,30-/m1/s1 |
| InChIKey | WZNZYLZSKLPKME-YCVRVPNXSA-N |
| XLogP | 6.16 |
| TPSA | 124.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|