C26H26N2O4S2 — CID 135069640
(NZ)-N-[[(1S,2S,5S,12S,22R)-13-methylsulfonyl-13-azaheptacyclo[13.9.0.01,22.02,5.02,12.06,11.016,21]tetracosa-6,8,10,14,16,18,20-heptaen-12-yl]methylidene]methanesulfonamide (PubChem CID 135069640) has the molecular formula C26H26N2O4S2 and a molecular weight of 494.64 g/mol. Its IUPAC name is (NZ)-N-[[(1S,2S,5S,12S,22R)-13-methylsulfonyl-13-azaheptacyclo[13.9.0.01,22.02,5.02,12.06,11.016,21]tetracosa-6,8,10,14,16,18,20-heptaen-12-yl]methylidene]methanesulfonamide.
| Compound Name | (NZ)-N-[[(1S,2S,5S,12S,22R)-13-methylsulfonyl-13-azaheptacyclo[13.9.0.01,22.02,5.02,12.06,11.016,21]tetracosa-6,8,10,14,16,18,20-heptaen-12-yl]methylidene]methanesulfonamide |
|---|---|
| PubChem CID | 135069640 |
| Molecular Formula | C26H26N2O4S2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | (NZ)-N-[[(1S,2S,5S,12S,22R)-13-methylsulfonyl-13-azaheptacyclo[13.9.0.01,22.02,5.02,12.06,11.016,21]tetracosa-6,8,10,14,16,18,20-heptaen-12-yl]methylidene]methanesulfonamide |
| SMILES | CS(=O)(=O)/N=C\[C@]12c3ccccc3[C@@H]3CC[C@@]31[C@@]13CC[C@@H]1c1ccccc1C3=CN2S(C)(=O)=O |
| InChI | InChI=1S/C26H26N2O4S2/c1-33(29,30)27-16-26-22-10-6-5-9-19(22)21-12-14-25(21,26)24-13-11-20(24)17-7-3-4-8-18(17)23(24)15-28(26)34(2,31)32/h3-10,15-16,20-21H,11-14H2,1-2H3/b27-16-/t20-,21+,24+,25+,26+/m1/s1 |
| InChIKey | ORHRPHGKYDTDEF-NYBJWNEXSA-N |
| XLogP | 3.98 |
| TPSA | 83.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|