C11H7Cl2NO3S — CID 5119668
N-(2,3-dichloro-4-oxonaphthalen-1-ylidene)methanesulfonamide (PubChem CID 5119668) has the molecular formula C11H7Cl2NO3S and a molecular weight of 304.15 g/mol. Its IUPAC name is N-(2,3-dichloro-4-oxonaphthalen-1-ylidene)methanesulfonamide.
| Compound Name | N-(2,3-dichloro-4-oxonaphthalen-1-ylidene)methanesulfonamide |
|---|---|
| PubChem CID | 5119668 |
| Molecular Formula | C11H7Cl2NO3S |
| Molecular Weight | 304.15 g/mol |
| Exact Mass | 302.95 |
| IUPAC Name | N-(2,3-dichloro-4-oxonaphthalen-1-ylidene)methanesulfonamide |
| SMILES | CS(=O)(=O)N=C1C(Cl)=C(Cl)C(=O)c2ccccc21 |
| InChI | InChI=1S/C11H7Cl2NO3S/c1-18(16,17)14-10-6-4-2-3-5-7(6)11(15)9(13)8(10)12/h2-5H,1H3 |
| InChIKey | AORJYFVBDNYLPJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.15 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|