C20H21FO5S2 — CID 135070602
3-[bis(benzenesulfonyl)-fluoromethyl]cycloheptan-1-one (PubChem CID 135070602) has the molecular formula C20H21FO5S2 and a molecular weight of 424.52 g/mol. Its IUPAC name is 3-[bis(benzenesulfonyl)-fluoromethyl]cycloheptan-1-one.
| Compound Name | 3-[bis(benzenesulfonyl)-fluoromethyl]cycloheptan-1-one |
|---|---|
| PubChem CID | 135070602 |
| Molecular Formula | C20H21FO5S2 |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 3-[bis(benzenesulfonyl)-fluoromethyl]cycloheptan-1-one |
| SMILES | O=C1CCCCC(C(F)(S(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C20H21FO5S2/c21-20(16-9-7-8-10-17(22)15-16,27(23,24)18-11-3-1-4-12-18)28(25,26)19-13-5-2-6-14-19/h1-6,11-14,16H,7-10,15H2 |
| InChIKey | YCZQNFUSZGAOSZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |