C30H47NO8Si — CID 135079030
[(2S,3R,5R)-5-methoxy-2-[(2S,4R)-4-methyl-6-oxooxan-2-yl]-5-[(2R,4S)-4-methyl-5-(2-trimethylsilylethoxycarbonylamino)pentan-2-yl]oxolan-3-yl] benzoate (PubChem CID 135079030) has the molecular formula C30H47NO8Si and a molecular weight of 577.79 g/mol. Its IUPAC name is [(2S,3R,5R)-5-methoxy-2-[(2S,4R)-4-methyl-6-oxooxan-2-yl]-5-[(2R,4S)-4-methyl-5-(2-trimethylsilylethoxycarbonylamino)pentan-2-yl]oxolan-3-yl] benzoate.
| Compound Name | [(2S,3R,5R)-5-methoxy-2-[(2S,4R)-4-methyl-6-oxooxan-2-yl]-5-[(2R,4S)-4-methyl-5-(2-trimethylsilylethoxycarbonylamino)pentan-2-yl]oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 135079030 |
| Molecular Formula | C30H47NO8Si |
| Molecular Weight | 577.79 g/mol |
| Exact Mass | 577.31 |
| IUPAC Name | [(2S,3R,5R)-5-methoxy-2-[(2S,4R)-4-methyl-6-oxooxan-2-yl]-5-[(2R,4S)-4-methyl-5-(2-trimethylsilylethoxycarbonylamino)pentan-2-yl]oxolan-3-yl] benzoate |
| SMILES | CO[C@]1([C@H](C)C[C@H](C)CNC(=O)OCC[Si](C)(C)C)C[C@@H](OC(=O)c2ccccc2)[C@H]([C@@H]2C[C@@H](C)CC(=O)O2)O1 |
| InChI | InChI=1S/C30H47NO8Si/c1-20-16-24(37-26(32)17-20)27-25(38-28(33)23-11-9-8-10-12-23)18-30(35-4,39-27)22(3)15-21(2)19-31-29(34)36-13-14-40(5,6)7/h8-12,20-22,24-25,27H,13-19H2,1-7H3,(H,31,34)/t20-,21+,22-,24+,25-,27+,30-/m1/s1 |
| InChIKey | LOQVQNAYZNFZKY-XDTLFOAWSA-N |
| XLogP | 5.41 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.79 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|