C15H16N2O4S — CID 135079855
[4-(4-methoxyphenyl)-1-oxo-1-(2-oxo-1,3-oxazolidin-3-yl)butan-2-yl] thiocyanate (PubChem CID 135079855) has the molecular formula C15H16N2O4S and a molecular weight of 320.37 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)-1-oxo-1-(2-oxo-1,3-oxazolidin-3-yl)butan-2-yl] thiocyanate.
| Compound Name | [4-(4-methoxyphenyl)-1-oxo-1-(2-oxo-1,3-oxazolidin-3-yl)butan-2-yl] thiocyanate |
|---|---|
| PubChem CID | 135079855 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | [4-(4-methoxyphenyl)-1-oxo-1-(2-oxo-1,3-oxazolidin-3-yl)butan-2-yl] thiocyanate |
| SMILES | COc1ccc(CCC(SC#N)C(=O)N2CCOC2=O)cc1 |
| InChI | InChI=1S/C15H16N2O4S/c1-20-12-5-2-11(3-6-12)4-7-13(22-10-16)14(18)17-8-9-21-15(17)19/h2-3,5-6,13H,4,7-9H2,1H3 |
| InChIKey | BUZPXKJJDWGLTO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|