C20H24BN — CID 135082418
(2R,5R)-N,N-diethyl-2,5-diphenyl-2,5-dihydroborol-1-amine (PubChem CID 135082418) has the molecular formula C20H24BN and a molecular weight of 289.23 g/mol. Its IUPAC name is (2R,5R)-N,N-diethyl-2,5-diphenyl-2,5-dihydroborol-1-amine.
| Compound Name | (2R,5R)-N,N-diethyl-2,5-diphenyl-2,5-dihydroborol-1-amine |
|---|---|
| PubChem CID | 135082418 |
| Molecular Formula | C20H24BN |
| Molecular Weight | 289.23 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | (2R,5R)-N,N-diethyl-2,5-diphenyl-2,5-dihydroborol-1-amine |
| SMILES | CCN(CC)B1[C@@H](c2ccccc2)C=C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H24BN/c1-3-22(4-2)21-19(17-11-7-5-8-12-17)15-16-20(21)18-13-9-6-10-14-18/h5-16,19-20H,3-4H2,1-2H3/t19-,20-/m1/s1 |
| InChIKey | WSWQKMGADQLDNA-WOJBJXKFSA-N |
| XLogP | 4.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.23 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|