C24H42O2P2 — CID 135083394
(1S,8S)-3,9-dicyclohexyl-5,12-dimethyl-3λ5,9λ5-diphosphatricyclo[6.2.2.02,7]dodecane 3,9-dioxide (PubChem CID 135083394) has the molecular formula C24H42O2P2 and a molecular weight of 424.55 g/mol. Its IUPAC name is (1S,8S)-3,9-dicyclohexyl-5,12-dimethyl-3λ5,9λ5-diphosphatricyclo[6.2.2.02,7]dodecane 3,9-dioxide.
| Compound Name | (1S,8S)-3,9-dicyclohexyl-5,12-dimethyl-3λ5,9λ5-diphosphatricyclo[6.2.2.02,7]dodecane 3,9-dioxide |
|---|---|
| PubChem CID | 135083394 |
| Molecular Formula | C24H42O2P2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | (1S,8S)-3,9-dicyclohexyl-5,12-dimethyl-3λ5,9λ5-diphosphatricyclo[6.2.2.02,7]dodecane 3,9-dioxide |
| SMILES | CC1CC2C([C@H]3CC(C)[C@@H]2P(=O)(C2CCCCC2)C3)P(=O)(C2CCCCC2)C1 |
| InChI | InChI=1S/C24H42O2P2/c1-17-13-22-23-18(2)14-19(16-28(23,26)21-11-7-4-8-12-21)24(22)27(25,15-17)20-9-5-3-6-10-20/h17-24H,3-16H2,1-2H3/t17?,18?,19-,22?,23-,24?,27?,28?/m0/s1 |
| InChIKey | XQXKNGUGXIPKNC-ZENJODAQSA-N |
| XLogP | 7.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|