C14H27N3O4S — CID 135140685
(2R)-2-[3-(2,2-dimethylpropylsulfanyl)propanoylamino]-3-[[2-(methylamino)acetyl]amino]propanoic acid (PubChem CID 135140685) has the molecular formula C14H27N3O4S and a molecular weight of 333.45 g/mol. Its IUPAC name is (2R)-2-[3-(2,2-dimethylpropylsulfanyl)propanoylamino]-3-[[2-(methylamino)acetyl]amino]propanoic acid.
| Compound Name | (2R)-2-[3-(2,2-dimethylpropylsulfanyl)propanoylamino]-3-[[2-(methylamino)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 135140685 |
| Molecular Formula | C14H27N3O4S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | (2R)-2-[3-(2,2-dimethylpropylsulfanyl)propanoylamino]-3-[[2-(methylamino)acetyl]amino]propanoic acid |
| SMILES | CNCC(=O)NC[C@@H](NC(=O)CCSCC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C14H27N3O4S/c1-14(2,3)9-22-6-5-11(18)17-10(13(20)21)7-16-12(19)8-15-4/h10,15H,5-9H2,1-4H3,(H,16,19)(H,17,18)(H,20,21)/t10-/m1/s1 |
| InChIKey | VYFHBTJHPXXMHJ-SNVBAGLBSA-N |
| XLogP | 0.06 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|