C28H34N4O5S — CID 135141644
3-[3-amino-4-[amino(methyl)amino]-5-methoxyphenyl]-3-[4-methyl-3-[[(4R)-4-methyl-1-oxo-3,4-dihydro-5,1λ4,2-benzoxathiazepin-2-yl]methyl]phenyl]propanoic acid (PubChem CID 135141644) has the molecular formula C28H34N4O5S and a molecular weight of 538.67 g/mol. Its IUPAC name is 3-[3-amino-4-[amino(methyl)amino]-5-methoxyphenyl]-3-[4-methyl-3-[[(4R)-4-methyl-1-oxo-3,4-dihydro-5,1λ4,2-benzoxathiazepin-2-yl]methyl]phenyl]propanoic acid.
| Compound Name | 3-[3-amino-4-[amino(methyl)amino]-5-methoxyphenyl]-3-[4-methyl-3-[[(4R)-4-methyl-1-oxo-3,4-dihydro-5,1λ4,2-benzoxathiazepin-2-yl]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 135141644 |
| Molecular Formula | C28H34N4O5S |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | 3-[3-amino-4-[amino(methyl)amino]-5-methoxyphenyl]-3-[4-methyl-3-[[(4R)-4-methyl-1-oxo-3,4-dihydro-5,1λ4,2-benzoxathiazepin-2-yl]methyl]phenyl]propanoic acid |
| SMILES | COc1cc(C(CC(=O)O)c2ccc(C)c(CN3C[C@@H](C)Oc4ccccc4S3=O)c2)cc(N)c1N(C)N |
| InChI | InChI=1S/C28H34N4O5S/c1-17-9-10-19(22(14-27(33)34)20-12-23(29)28(31(3)30)25(13-20)36-4)11-21(17)16-32-15-18(2)37-24-7-5-6-8-26(24)38(32)35/h5-13,18,22H,14-16,29-30H2,1-4H3,(H,33,34)/t18-,22?,38?/m1/s1 |
| InChIKey | VCJCGDIVYBKQJC-JPECVWCQSA-N |
| XLogP | 3.81 |
| TPSA | 131.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|