C31H39F3N4O3S2 — CID 135143723
3-[3-amino-4-(ethylamino)-2-methylphenyl]-3-[4-[[(4S)-4-ethyl-1-oxo-8-(trifluoromethyl)-4,5-dihydro-3H-1λ4,2-benzothiazepin-2-yl]methyl]-5-methyl-1,3-thiazol-2-yl]-2,2-dimethylpropanoic acid (PubChem CID 135143723) has the molecular formula C31H39F3N4O3S2 and a molecular weight of 636.81 g/mol. Its IUPAC name is 3-[3-amino-4-(ethylamino)-2-methylphenyl]-3-[4-[[(4S)-4-ethyl-1-oxo-8-(trifluoromethyl)-4,5-dihydro-3H-1λ4,2-benzothiazepin-2-yl]methyl]-5-methyl-1,3-thiazol-2-yl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[3-amino-4-(ethylamino)-2-methylphenyl]-3-[4-[[(4S)-4-ethyl-1-oxo-8-(trifluoromethyl)-4,5-dihydro-3H-1λ4,2-benzothiazepin-2-yl]methyl]-5-methyl-1,3-thiazol-2-yl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 135143723 |
| Molecular Formula | C31H39F3N4O3S2 |
| Molecular Weight | 636.81 g/mol |
| Exact Mass | 636.24 |
| IUPAC Name | 3-[3-amino-4-(ethylamino)-2-methylphenyl]-3-[4-[[(4S)-4-ethyl-1-oxo-8-(trifluoromethyl)-4,5-dihydro-3H-1λ4,2-benzothiazepin-2-yl]methyl]-5-methyl-1,3-thiazol-2-yl]-2,2-dimethylpropanoic acid |
| SMILES | CCNc1ccc(C(c2nc(CN3C[C@@H](CC)Cc4ccc(C(F)(F)F)cc4S3=O)c(C)s2)C(C)(C)C(=O)O)c(C)c1N |
| InChI | InChI=1S/C31H39F3N4O3S2/c1-7-19-13-20-9-10-21(31(32,33)34)14-25(20)43(41)38(15-19)16-24-18(4)42-28(37-24)26(30(5,6)29(39)40)22-11-12-23(36-8-2)27(35)17(22)3/h9-12,14,19,26,36H,7-8,13,15-16,35H2,1-6H3,(H,39,40)/t19-,26?,43?/m0/s1 |
| InChIKey | ROLICEUAPXMRFP-FAYQOREVSA-N |
| XLogP | 7.14 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.81 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|