C18H20ClN5O3S — CID 135150563
[(1S,2S,6R,7R)-10-(2-chloro-6-methylphenyl)sulfonyl-4,10-diazatricyclo[5.2.1.02,6]decan-4-yl]-(2H-triazol-4-yl)methanone (PubChem CID 135150563) has the molecular formula C18H20ClN5O3S and a molecular weight of 421.91 g/mol. Its IUPAC name is [(1S,2S,6R,7R)-10-(2-chloro-6-methylphenyl)sulfonyl-4,10-diazatricyclo[5.2.1.02,6]decan-4-yl]-(2H-triazol-4-yl)methanone.
| Compound Name | [(1S,2S,6R,7R)-10-(2-chloro-6-methylphenyl)sulfonyl-4,10-diazatricyclo[5.2.1.02,6]decan-4-yl]-(2H-triazol-4-yl)methanone |
|---|---|
| PubChem CID | 135150563 |
| Molecular Formula | C18H20ClN5O3S |
| Molecular Weight | 421.91 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | [(1S,2S,6R,7R)-10-(2-chloro-6-methylphenyl)sulfonyl-4,10-diazatricyclo[5.2.1.02,6]decan-4-yl]-(2H-triazol-4-yl)methanone |
| SMILES | Cc1cccc(Cl)c1S(=O)(=O)N1[C@@H]2CC[C@H]1[C@@H]1CN(C(=O)c3cn[nH]n3)C[C@@H]12 |
| InChI | InChI=1S/C18H20ClN5O3S/c1-10-3-2-4-13(19)17(10)28(26,27)24-15-5-6-16(24)12-9-23(8-11(12)15)18(25)14-7-20-22-21-14/h2-4,7,11-12,15-16H,5-6,8-9H2,1H3,(H,20,21,22)/t11-,12+,15+,16- |
| InChIKey | GUTHSTPBOGXARF-CRJCFHLZSA-N |
| XLogP | 1.69 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.91 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |