C23H24ClIN4O4S2 — CID 135159852
ethyl (3R,6S)-3-(2-chloro-4-iodophenyl)-6-[cyclopropylsulfonyl(methyl)amino]-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate (PubChem CID 135159852) has the molecular formula C23H24ClIN4O4S2 and a molecular weight of 646.96 g/mol. Its IUPAC name is ethyl (3R,6S)-3-(2-chloro-4-iodophenyl)-6-[cyclopropylsulfonyl(methyl)amino]-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate.
| Compound Name | ethyl (3R,6S)-3-(2-chloro-4-iodophenyl)-6-[cyclopropylsulfonyl(methyl)amino]-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 135159852 |
| Molecular Formula | C23H24ClIN4O4S2 |
| Molecular Weight | 646.96 g/mol |
| Exact Mass | 646.00 |
| IUPAC Name | ethyl (3R,6S)-3-(2-chloro-4-iodophenyl)-6-[cyclopropylsulfonyl(methyl)amino]-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
| SMILES | CCOC(=O)C1=C2C[C@H](N(C)S(=O)(=O)C3CC3)CN2C(c2nccs2)=N[C@H]1c1ccc(I)cc1Cl |
| InChI | InChI=1S/C23H24ClIN4O4S2/c1-3-33-23(30)19-18-11-14(28(2)35(31,32)15-5-6-15)12-29(18)21(22-26-8-9-34-22)27-20(19)16-7-4-13(25)10-17(16)24/h4,7-10,14-15,20H,3,5-6,11-12H2,1-2H3/t14-,20-/m0/s1 |
| InChIKey | APEONJDKZFIGJJ-XOBRGWDASA-N |
| XLogP | 4.22 |
| TPSA | 92.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.96 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|