C10H18N2O — CID 135190101
(Z,3R)-4,7-diimino-5,6-dimethyloct-5-en-3-ol (PubChem CID 135190101) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is (Z,3R)-4,7-diimino-5,6-dimethyloct-5-en-3-ol.
| Compound Name | (Z,3R)-4,7-diimino-5,6-dimethyloct-5-en-3-ol |
|---|---|
| PubChem CID | 135190101 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | (Z,3R)-4,7-diimino-5,6-dimethyloct-5-en-3-ol |
| SMILES | [H]/N=C(C(/C)=C(C)\C(C)=N\[H])\[C@H](O)CC |
| InChI | InChI=1S/C10H18N2O/c1-5-9(13)10(12)7(3)6(2)8(4)11/h9,11-13H,5H2,1-4H3/b7-6-,11-8+,12-10-/t9-/m1/s1 |
| InChIKey | BGILLXIHROPNGM-WVQVZHNMSA-N |
| XLogP | 2.15 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|