C10H18N2O — CID 137227661
(NZ)-N-[(Z)-2-imino-4,5,6-trimethylhept-4-en-3-ylidene]hydroxylamine (PubChem CID 137227661) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is (NZ)-N-[(Z)-2-imino-4,5,6-trimethylhept-4-en-3-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(Z)-2-imino-4,5,6-trimethylhept-4-en-3-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 137227661 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | (NZ)-N-[(Z)-2-imino-4,5,6-trimethylhept-4-en-3-ylidene]hydroxylamine |
| SMILES | [H]/N=C(C)/C(=N\O)C(/C)=C(/C)C(C)C |
| InChI | InChI=1S/C10H18N2O/c1-6(2)7(3)8(4)10(12-13)9(5)11/h6,11,13H,1-5H3/b8-7-,11-9+,12-10- |
| InChIKey | PQLDNSLFVWMFRM-PZLMTMASSA-N |
| XLogP | 2.85 |
| TPSA | 56.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|