C18H22N6O9S2 — CID 135213666
[7-(dimethylcarbamoyl)-5-methyl-9-oxo-3-[(4-sulfamoylphenoxy)methyl]-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate (PubChem CID 135213666) has the molecular formula C18H22N6O9S2 and a molecular weight of 530.54 g/mol. Its IUPAC name is [7-(dimethylcarbamoyl)-5-methyl-9-oxo-3-[(4-sulfamoylphenoxy)methyl]-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate.
| Compound Name | [7-(dimethylcarbamoyl)-5-methyl-9-oxo-3-[(4-sulfamoylphenoxy)methyl]-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 135213666 |
| Molecular Formula | C18H22N6O9S2 |
| Molecular Weight | 530.54 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | [7-(dimethylcarbamoyl)-5-methyl-9-oxo-3-[(4-sulfamoylphenoxy)methyl]-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
| SMILES | CN(C)C(=O)C1c2c(c(COc3ccc(S(N)(=O)=O)cc3)nn2C)C2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C18H22N6O9S2/c1-21(2)17(25)16-15-14(13-8-23(16)18(26)24(13)33-35(29,30)31)12(20-22(15)3)9-32-10-4-6-11(7-5-10)34(19,27)28/h4-7,13,16H,8-9H2,1-3H3,(H2,19,27,28)(H,29,30,31) |
| InChIKey | MVELZLPQNRTWRF-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 194.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.54 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|