C19H24N6O7S — CID 135213608
[3-[[4-(aminomethyl)phenoxy]methyl]-7-(dimethylcarbamoyl)-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate (PubChem CID 135213608) has the molecular formula C19H24N6O7S and a molecular weight of 480.50 g/mol. Its IUPAC name is [3-[[4-(aminomethyl)phenoxy]methyl]-7-(dimethylcarbamoyl)-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate.
| Compound Name | [3-[[4-(aminomethyl)phenoxy]methyl]-7-(dimethylcarbamoyl)-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 135213608 |
| Molecular Formula | C19H24N6O7S |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | [3-[[4-(aminomethyl)phenoxy]methyl]-7-(dimethylcarbamoyl)-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
| SMILES | CN(C)C(=O)C1c2c(c(COc3ccc(CN)cc3)nn2C)C2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C19H24N6O7S/c1-22(2)18(26)17-16-15(14-9-24(17)19(27)25(14)32-33(28,29)30)13(21-23(16)3)10-31-12-6-4-11(8-20)5-7-12/h4-7,14,17H,8-10,20H2,1-3H3,(H,28,29,30) |
| InChIKey | LQXTYJBTUIVAFW-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 160.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|