C17H20N6O7S — CID 135213612
[7-(dimethylcarbamoyl)-5-methyl-9-oxo-3-(pyridin-2-yloxymethyl)-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate (PubChem CID 135213612) has the molecular formula C17H20N6O7S and a molecular weight of 452.45 g/mol. Its IUPAC name is [7-(dimethylcarbamoyl)-5-methyl-9-oxo-3-(pyridin-2-yloxymethyl)-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate.
| Compound Name | [7-(dimethylcarbamoyl)-5-methyl-9-oxo-3-(pyridin-2-yloxymethyl)-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 135213612 |
| Molecular Formula | C17H20N6O7S |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | [7-(dimethylcarbamoyl)-5-methyl-9-oxo-3-(pyridin-2-yloxymethyl)-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
| SMILES | CN(C)C(=O)C1c2c(c(COc3ccccn3)nn2C)C2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C17H20N6O7S/c1-20(2)16(24)15-14-13(11-8-22(15)17(25)23(11)30-31(26,27)28)10(19-21(14)3)9-29-12-6-4-5-7-18-12/h4-7,11,15H,8-9H2,1-3H3,(H,26,27,28) |
| InChIKey | FVQJIEPDNCRPIT-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 147.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|