C35H47N3O4 — CID 135226571
3-[2-[2-[(1-benzyltriazol-4-yl)methoxy]ethoxy]ethoxy]-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenol (PubChem CID 135226571) has the molecular formula C35H47N3O4 and a molecular weight of 573.78 g/mol. Its IUPAC name is 3-[2-[2-[(1-benzyltriazol-4-yl)methoxy]ethoxy]ethoxy]-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenol.
| Compound Name | 3-[2-[2-[(1-benzyltriazol-4-yl)methoxy]ethoxy]ethoxy]-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenol |
|---|---|
| PubChem CID | 135226571 |
| Molecular Formula | C35H47N3O4 |
| Molecular Weight | 573.78 g/mol |
| Exact Mass | 573.36 |
| IUPAC Name | 3-[2-[2-[(1-benzyltriazol-4-yl)methoxy]ethoxy]ethoxy]-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenol |
| SMILES | C=C(C)C1CCC(C)=CC1c1c(O)cc(CCCCC)cc1OCCOCCOCc1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C35H47N3O4/c1-5-6-8-13-29-21-33(39)35(32-20-27(4)14-15-31(32)26(2)3)34(22-29)42-19-18-40-16-17-41-25-30-24-38(37-36-30)23-28-11-9-7-10-12-28/h7,9-12,20-22,24,31-32,39H,2,5-6,8,13-19,23,25H2,1,3-4H3 |
| InChIKey | JSEADNGNCXBXLT-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 78.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.78 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|