C28H32N6O3S2 — CID 135234111
2-(4-methoxycyclohexa-1,3-dien-1-yl)-N-[5-[3-[5-[3-(4-methoxyphenyl)prop-1-en-2-ylamino]-1,3,4-thiadiazol-2-yl]cyclopentyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 135234111) has the molecular formula C28H32N6O3S2 and a molecular weight of 564.74 g/mol. Its IUPAC name is 2-(4-methoxycyclohexa-1,3-dien-1-yl)-N-[5-[3-[5-[3-(4-methoxyphenyl)prop-1-en-2-ylamino]-1,3,4-thiadiazol-2-yl]cyclopentyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(4-methoxycyclohexa-1,3-dien-1-yl)-N-[5-[3-[5-[3-(4-methoxyphenyl)prop-1-en-2-ylamino]-1,3,4-thiadiazol-2-yl]cyclopentyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 135234111 |
| Molecular Formula | C28H32N6O3S2 |
| Molecular Weight | 564.74 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | 2-(4-methoxycyclohexa-1,3-dien-1-yl)-N-[5-[3-[5-[3-(4-methoxyphenyl)prop-1-en-2-ylamino]-1,3,4-thiadiazol-2-yl]cyclopentyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | C=C(Cc1ccc(OC)cc1)Nc1nnc(C2CCC(c3nnc(NC(=O)CC4=CC=C(OC)CC4)s3)C2)s1 |
| InChI | InChI=1S/C28H32N6O3S2/c1-17(14-18-4-10-22(36-2)11-5-18)29-27-33-31-25(38-27)20-8-9-21(16-20)26-32-34-28(39-26)30-24(35)15-19-6-12-23(37-3)13-7-19/h4-6,10-12,20-21H,1,7-9,13-16H2,2-3H3,(H,29,33)(H,30,34,35) |
| InChIKey | RBFRXYNZYNZAMV-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.74 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |