C29H35N5O4S2 — CID 144630866
1-[[2-(4-methoxyphenyl)acetyl]amino]ethyl 3-[5-[[2-(4-methoxyphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]-N-methylcyclopentane-1-carboximidothioate (PubChem CID 144630866) has the molecular formula C29H35N5O4S2 and a molecular weight of 581.76 g/mol. Its IUPAC name is 1-[[2-(4-methoxyphenyl)acetyl]amino]ethyl 3-[5-[[2-(4-methoxyphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]-N-methylcyclopentane-1-carboximidothioate.
| Compound Name | 1-[[2-(4-methoxyphenyl)acetyl]amino]ethyl 3-[5-[[2-(4-methoxyphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]-N-methylcyclopentane-1-carboximidothioate |
|---|---|
| PubChem CID | 144630866 |
| Molecular Formula | C29H35N5O4S2 |
| Molecular Weight | 581.76 g/mol |
| Exact Mass | 581.21 |
| IUPAC Name | 1-[[2-(4-methoxyphenyl)acetyl]amino]ethyl 3-[5-[[2-(4-methoxyphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]-N-methylcyclopentane-1-carboximidothioate |
| SMILES | C/N=C(\SC(C)NC(=O)Cc1ccc(OC)cc1)C1CCC(c2nnc(NC(=O)Cc3ccc(OC)cc3)s2)C1 |
| InChI | InChI=1S/C29H35N5O4S2/c1-18(31-25(35)15-19-5-11-23(37-3)12-6-19)39-27(30-2)21-9-10-22(17-21)28-33-34-29(40-28)32-26(36)16-20-7-13-24(38-4)14-8-20/h5-8,11-14,18,21-22H,9-10,15-17H2,1-4H3,(H,31,35)(H,32,34,36)/b30-27- |
| InChIKey | JEYDXKGNCUBFOL-IKPAITLHSA-N |
| XLogP | 5.09 |
| TPSA | 114.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.76 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|