C9H13ClN2O4 — CID 135238426
5-carbonochloridoyl-3a-methoxy-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-2-carboxylic acid (PubChem CID 135238426) has the molecular formula C9H13ClN2O4 and a molecular weight of 248.67 g/mol. Its IUPAC name is 5-carbonochloridoyl-3a-methoxy-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-2-carboxylic acid.
| Compound Name | 5-carbonochloridoyl-3a-methoxy-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 135238426 |
| Molecular Formula | C9H13ClN2O4 |
| Molecular Weight | 248.67 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 5-carbonochloridoyl-3a-methoxy-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-2-carboxylic acid |
| SMILES | COC12CN(C(=O)O)CC1CN(C(=O)Cl)C2 |
| InChI | InChI=1S/C9H13ClN2O4/c1-16-9-4-11(7(10)13)2-6(9)3-12(5-9)8(14)15/h6H,2-5H2,1H3,(H,14,15) |
| InChIKey | ZVACNCIJHSRAKV-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.67 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|