C19H18N4O2 — CID 135245768
[(E)-1-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-2-phenylprop-1-enyl]-methyldiazene (PubChem CID 135245768) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is [(E)-1-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-2-phenylprop-1-enyl]-methyldiazene.
| Compound Name | [(E)-1-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-2-phenylprop-1-enyl]-methyldiazene |
|---|---|
| PubChem CID | 135245768 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | [(E)-1-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-2-phenylprop-1-enyl]-methyldiazene |
| SMILES | C/N=N/C(=C(\C)c1ccccc1)c1nc(-c2ccccc2OC)no1 |
| InChI | InChI=1S/C19H18N4O2/c1-13(14-9-5-4-6-10-14)17(22-20-2)19-21-18(23-25-19)15-11-7-8-12-16(15)24-3/h4-12H,1-3H3/b17-13+,22-20+ |
| InChIKey | QICRBYKCFKCNJZ-UGFLLLHASA-N |
| XLogP | 4.72 |
| TPSA | 72.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|