C26H29N3O6 — CID 135307862
tert-butyl 4-(4-nitrophenyl)-5-[(3-oxo-1,2-dihydroisoindol-5-yl)oxymethyl]-2,3,6,7-tetrahydroazepine-1-carboxylate (PubChem CID 135307862) has the molecular formula C26H29N3O6 and a molecular weight of 479.53 g/mol. Its IUPAC name is tert-butyl 4-(4-nitrophenyl)-5-[(3-oxo-1,2-dihydroisoindol-5-yl)oxymethyl]-2,3,6,7-tetrahydroazepine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-nitrophenyl)-5-[(3-oxo-1,2-dihydroisoindol-5-yl)oxymethyl]-2,3,6,7-tetrahydroazepine-1-carboxylate |
|---|---|
| PubChem CID | 135307862 |
| Molecular Formula | C26H29N3O6 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | tert-butyl 4-(4-nitrophenyl)-5-[(3-oxo-1,2-dihydroisoindol-5-yl)oxymethyl]-2,3,6,7-tetrahydroazepine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(COc2ccc3c(c2)C(=O)NC3)=C(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C26H29N3O6/c1-26(2,3)35-25(31)28-12-10-19(16-34-21-9-6-18-15-27-24(30)23(18)14-21)22(11-13-28)17-4-7-20(8-5-17)29(32)33/h4-9,14H,10-13,15-16H2,1-3H3,(H,27,30) |
| InChIKey | JLPDYBCQTHCFPF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|