C27H35N3O — CID 135319637
6-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-11-one (PubChem CID 135319637) has the molecular formula C27H35N3O and a molecular weight of 417.60 g/mol. Its IUPAC name is 6-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-11-one.
| Compound Name | 6-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-11-one |
|---|---|
| PubChem CID | 135319637 |
| Molecular Formula | C27H35N3O |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.28 |
| IUPAC Name | 6-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-11-one |
| SMILES | Cc1cccc(N2CCN(CCCCc3cc4c5c(c3)CCN5C(=O)CC4)CC2)c1C |
| InChI | InChI=1S/C27H35N3O/c1-20-6-5-8-25(21(20)2)29-16-14-28(15-17-29)12-4-3-7-22-18-23-9-10-26(31)30-13-11-24(19-22)27(23)30/h5-6,8,18-19H,3-4,7,9-17H2,1-2H3 |
| InChIKey | YGRYBAHCSWVCRF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|