C5H9NO7 — CID 135334074
(2R,3R,4R,5R)-5-nitrooxane-2,3,4,5-tetrol (PubChem CID 135334074) has the molecular formula C5H9NO7 and a molecular weight of 195.13 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-nitrooxane-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4R,5R)-5-nitrooxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 135334074 |
| Molecular Formula | C5H9NO7 |
| Molecular Weight | 195.13 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | (2R,3R,4R,5R)-5-nitrooxane-2,3,4,5-tetrol |
| SMILES | O=[N+]([O-])[C@@]1(O)CO[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C5H9NO7/c7-2-3(8)5(10,6(11)12)1-13-4(2)9/h2-4,7-10H,1H2/t2-,3-,4-,5-/m1/s1 |
| InChIKey | XPJPVVOFNUINBO-TXICZTDVSA-N |
| XLogP | -2.98 |
| TPSA | 133.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.13 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|