C9H18N2O7 — CID 174690722
[(3S,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]-trimethylazanium nitrate (PubChem CID 174690722) has the molecular formula C9H18N2O7 and a molecular weight of 266.25 g/mol. Its IUPAC name is [(3S,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]-trimethylazanium nitrate.
| Compound Name | [(3S,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]-trimethylazanium nitrate |
|---|---|
| PubChem CID | 174690722 |
| Molecular Formula | C9H18N2O7 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | [(3S,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]-trimethylazanium nitrate |
| SMILES | C[N+](C)(C)[C@]1(O)CO[C@@H]2[C@@H](O)CO[C@@H]21.O=[N+]([O-])[O-] |
| InChI | InChI=1S/C9H18NO4.NO3/c1-10(2,3)9(12)5-14-7-6(11)4-13-8(7)9;2-1(3)4/h6-8,11-12H,4-5H2,1-3H3;/q+1;-1/t6-,7+,8-,9-;/m0./s1 |
| InChIKey | WOJRVOJHJBSHBM-XQVZEVJTSA-N |
| XLogP | -1.70 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|