C14H25NO8 — CID 174730606
[3-[(3S,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]-3-(1-hydroxyethyl)hexan-2-yl] nitrate (PubChem CID 174730606) has the molecular formula C14H25NO8 and a molecular weight of 335.35 g/mol. Its IUPAC name is [3-[(3S,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]-3-(1-hydroxyethyl)hexan-2-yl] nitrate.
| Compound Name | [3-[(3S,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]-3-(1-hydroxyethyl)hexan-2-yl] nitrate |
|---|---|
| PubChem CID | 174730606 |
| Molecular Formula | C14H25NO8 |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | [3-[(3S,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]-3-(1-hydroxyethyl)hexan-2-yl] nitrate |
| SMILES | CCCC(C(C)O)(C(C)O[N+](=O)[O-])[C@]1(O)CO[C@@H]2[C@@H](O)CO[C@@H]21 |
| InChI | InChI=1S/C14H25NO8/c1-4-5-13(8(2)16,9(3)23-15(19)20)14(18)7-22-11-10(17)6-21-12(11)14/h8-12,16-18H,4-7H2,1-3H3/t8?,9?,10-,11+,12-,13?,14-/m0/s1 |
| InChIKey | ZYBUQACZMKBNAP-BGGDABRHSA-N |
| XLogP | -0.36 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|