C10H16NNaO10S — CID 175324421
sodium 4-[(3S,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]-4-nitrooxybutane-2-sulfonate (PubChem CID 175324421) has the molecular formula C10H16NNaO10S and a molecular weight of 365.29 g/mol. Its IUPAC name is sodium 4-[(3S,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]-4-nitrooxybutane-2-sulfonate.
| Compound Name | sodium 4-[(3S,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]-4-nitrooxybutane-2-sulfonate |
|---|---|
| PubChem CID | 175324421 |
| Molecular Formula | C10H16NNaO10S |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | sodium 4-[(3S,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]-4-nitrooxybutane-2-sulfonate |
| SMILES | CC(CC(O[N+](=O)[O-])[C@]1(O)CO[C@@H]2[C@@H](O)CO[C@@H]21)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C10H17NO10S.Na/c1-5(22(16,17)18)2-7(21-11(14)15)10(13)4-20-8-6(12)3-19-9(8)10;/h5-9,12-13H,2-4H2,1H3,(H,16,17,18);/q;+1/p-1/t5?,6-,7?,8+,9-,10+;/m0./s1 |
| InChIKey | DNMUJPBDISAEOJ-JPZHWZRASA-M |
| XLogP | -5.22 |
| TPSA | 168.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | -5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|