C12H19NO7 — CID 174720958
[4-[(3R,3aR,6R,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]cyclohexyl] nitrate (PubChem CID 174720958) has the molecular formula C12H19NO7 and a molecular weight of 289.28 g/mol. Its IUPAC name is [4-[(3R,3aR,6R,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]cyclohexyl] nitrate.
| Compound Name | [4-[(3R,3aR,6R,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]cyclohexyl] nitrate |
|---|---|
| PubChem CID | 174720958 |
| Molecular Formula | C12H19NO7 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | [4-[(3R,3aR,6R,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]cyclohexyl] nitrate |
| SMILES | O=[N+]([O-])OC1CCC([C@@]2(O)CO[C@@H]3[C@H](O)CO[C@@H]32)CC1 |
| InChI | InChI=1S/C12H19NO7/c14-9-5-18-11-10(9)19-6-12(11,15)7-1-3-8(4-2-7)20-13(16)17/h7-11,14-15H,1-6H2/t7?,8?,9-,10-,11+,12+/m1/s1 |
| InChIKey | XGGZGDDXBXEAAW-DKTKPETGSA-N |
| XLogP | -0.36 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|