C6H10FNO6 — CID 174923244
(3S,3aR,6S,6aS)-6-nitro-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-3,6-diol;hydrofluoride (PubChem CID 174923244) has the molecular formula C6H10FNO6 and a molecular weight of 211.14 g/mol. Its IUPAC name is (3S,3aR,6S,6aS)-6-nitro-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-3,6-diol;hydrofluoride.
| Compound Name | (3S,3aR,6S,6aS)-6-nitro-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-3,6-diol;hydrofluoride |
|---|---|
| PubChem CID | 174923244 |
| Molecular Formula | C6H10FNO6 |
| Molecular Weight | 211.14 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | (3S,3aR,6S,6aS)-6-nitro-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-3,6-diol;hydrofluoride |
| SMILES | F.O=[N+]([O-])[C@]1(O)CO[C@@H]2[C@@H](O)CO[C@@H]21 |
| InChI | InChI=1S/C6H9NO6.FH/c8-3-1-12-5-4(3)13-2-6(5,9)7(10)11;/h3-5,8-9H,1-2H2;1H/t3-,4+,5-,6-;/m0./s1 |
| InChIKey | NKPNZVZCKNLFKF-WBHXJHRCSA-N |
| XLogP | -1.74 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.14 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|