C18H28NO15+ — CID 69339539
(3S,3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol;bis[[(3R,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]oxy]-oxoazanium (PubChem CID 69339539) has the molecular formula C18H28NO15+ and a molecular weight of 498.41 g/mol. Its IUPAC name is (3S,3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol;bis[[(3R,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]oxy]-oxoazanium.
| Compound Name | (3S,3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol;bis[[(3R,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]oxy]-oxoazanium |
|---|---|
| PubChem CID | 69339539 |
| Molecular Formula | C18H28NO15+ |
| Molecular Weight | 498.41 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | (3S,3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol;bis[[(3R,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]oxy]-oxoazanium |
| SMILES | O=[N+](O[C@@]1(O)CO[C@@H]2[C@H](O)CO[C@@H]21)O[C@@]1(O)CO[C@@H]2[C@H](O)CO[C@@H]21.O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2O |
| InChI | InChI=1S/C12H18NO11.C6H10O4/c14-5-1-19-9-7(5)21-3-11(9,16)23-13(18)24-12(17)4-22-8-6(15)2-20-10(8)12;7-3-1-9-6-4(8)2-10-5(3)6/h5-10,14-17H,1-4H2;3-8H,1-2H2/q+1;/t5-,6-,7-,8-,9+,10+,11+,12+;3-,4+,5-,6-/m11/s1 |
| InChIKey | DJWSPHUNSVCXIE-QAJBFZIKSA-N |
| XLogP | -5.17 |
| TPSA | 215.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.41 |
| LogP ≤ 5 | -5.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|