C11H15NO10 — CID 174729994
[(3R,3aR,6R,6aS)-3-hydroxy-6-nitrooxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl] 1,4-dioxane-2-carboxylate (PubChem CID 174729994) has the molecular formula C11H15NO10 and a molecular weight of 321.24 g/mol. Its IUPAC name is [(3R,3aR,6R,6aS)-3-hydroxy-6-nitrooxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl] 1,4-dioxane-2-carboxylate.
| Compound Name | [(3R,3aR,6R,6aS)-3-hydroxy-6-nitrooxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl] 1,4-dioxane-2-carboxylate |
|---|---|
| PubChem CID | 174729994 |
| Molecular Formula | C11H15NO10 |
| Molecular Weight | 321.24 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | [(3R,3aR,6R,6aS)-3-hydroxy-6-nitrooxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl] 1,4-dioxane-2-carboxylate |
| SMILES | O=C(O[C@@]1(O[N+](=O)[O-])CO[C@@H]2[C@H](O)CO[C@@H]21)C1COCCO1 |
| InChI | InChI=1S/C11H15NO10/c13-6-3-19-9-8(6)20-5-11(9,22-12(15)16)21-10(14)7-4-17-1-2-18-7/h6-9,13H,1-5H2/t6-,7?,8-,9+,11-/m1/s1 |
| InChIKey | BLBUSZUFQCEBMK-WEZAVFHMSA-N |
| XLogP | -1.99 |
| TPSA | 135.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.24 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|