C13H22O4 — CID 135370518
7-ethyl-4,9-dihydroxyundec-7-ene-3,6-dione (PubChem CID 135370518) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is 7-ethyl-4,9-dihydroxyundec-7-ene-3,6-dione.
| Compound Name | 7-ethyl-4,9-dihydroxyundec-7-ene-3,6-dione |
|---|---|
| PubChem CID | 135370518 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 7-ethyl-4,9-dihydroxyundec-7-ene-3,6-dione |
| SMILES | CCC(=O)C(O)CC(=O)C(=CC(O)CC)CC |
| InChI | InChI=1S/C13H22O4/c1-4-9(7-10(14)5-2)12(16)8-13(17)11(15)6-3/h7,10,13-14,17H,4-6,8H2,1-3H3 |
| InChIKey | CYGJFSHNKYCQCA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|