C9H20O7P2 — CID 135389562
(2-cyclohexyl-1-hydroxy-1-phosphonopropyl)phosphonic acid (PubChem CID 135389562) has the molecular formula C9H20O7P2 and a molecular weight of 302.20 g/mol. Its IUPAC name is (2-cyclohexyl-1-hydroxy-1-phosphonopropyl)phosphonic acid.
| Compound Name | (2-cyclohexyl-1-hydroxy-1-phosphonopropyl)phosphonic acid |
|---|---|
| PubChem CID | 135389562 |
| Molecular Formula | C9H20O7P2 |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | (2-cyclohexyl-1-hydroxy-1-phosphonopropyl)phosphonic acid |
| SMILES | CC(C1CCCCC1)C(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C9H20O7P2/c1-7(8-5-3-2-4-6-8)9(10,17(11,12)13)18(14,15)16/h7-8,10H,2-6H2,1H3,(H2,11,12,13)(H2,14,15,16) |
| InChIKey | DSJDQDZZOGHJAT-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|